C27H28N4O2 — CID 158391372
ethane;1-[3-[3-(4-phenoxyphenyl)pyrazolo[4,3-c]pyridin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 158391372) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is ethane;1-[3-[3-(4-phenoxyphenyl)pyrazolo[4,3-c]pyridin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | ethane;1-[3-[3-(4-phenoxyphenyl)pyrazolo[4,3-c]pyridin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 158391372 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | ethane;1-[3-[3-(4-phenoxyphenyl)pyrazolo[4,3-c]pyridin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(n2nc(-c3ccc(Oc4ccccc4)cc3)c3cnccc32)C1.CC |
| InChI | InChI=1S/C25H22N4O2.C2H6/c1-2-24(30)28-15-13-19(17-28)29-23-12-14-26-16-22(23)25(27-29)18-8-10-21(11-9-18)31-20-6-4-3-5-7-20;1-2/h2-12,14,16,19H,1,13,15,17H2;1-2H3 |
| InChIKey | GWZUEYYQRYUYFS-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|