C25H30N6O3S — CID 139465267
1-[(3R)-3-[3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]pyrazolo[4,3-c]pyridin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 139465267) has the molecular formula C25H30N6O3S and a molecular weight of 494.62 g/mol. Its IUPAC name is 1-[(3R)-3-[3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]pyrazolo[4,3-c]pyridin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]pyrazolo[4,3-c]pyridin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139465267 |
| Molecular Formula | C25H30N6O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 1-[(3R)-3-[3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]pyrazolo[4,3-c]pyridin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(N4CCN(S(C)(=O)=O)CC4)cc3)c3cnccc32)C1 |
| InChI | InChI=1S/C25H30N6O3S/c1-3-24(32)29-12-4-5-21(18-29)31-23-10-11-26-17-22(23)25(27-31)19-6-8-20(9-7-19)28-13-15-30(16-14-28)35(2,33)34/h3,6-11,17,21H,1,4-5,12-16,18H2,2H3/t21-/m1/s1 |
| InChIKey | PTZXELRTJAPRDH-OAQYLSRUSA-N |
| XLogP | 2.53 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|