C26H21FN6O2 — CID 134521449
4-[4-[7-fluoro-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[4,3-c]pyridin-3-yl]phenoxy]pyridine-3-carbonitrile (PubChem CID 134521449) has the molecular formula C26H21FN6O2 and a molecular weight of 468.49 g/mol. Its IUPAC name is 4-[4-[7-fluoro-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[4,3-c]pyridin-3-yl]phenoxy]pyridine-3-carbonitrile.
| Compound Name | 4-[4-[7-fluoro-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[4,3-c]pyridin-3-yl]phenoxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134521449 |
| Molecular Formula | C26H21FN6O2 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 4-[4-[7-fluoro-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[4,3-c]pyridin-3-yl]phenoxy]pyridine-3-carbonitrile |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4ccncc4C#N)cc3)c3cncc(F)c32)C1 |
| InChI | InChI=1S/C26H21FN6O2/c1-2-24(34)32-11-3-4-19(16-32)33-26-21(14-30-15-22(26)27)25(31-33)17-5-7-20(8-6-17)35-23-9-10-29-13-18(23)12-28/h2,5-10,13-15,19H,1,3-4,11,16H2/t19-/m1/s1 |
| InChIKey | PMNVRMOVGHHYDI-LJQANCHMSA-N |
| XLogP | 4.65 |
| TPSA | 96.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|