C26H22ClN7O2 — CID 134521416
4-[4-[4-amino-7-chloro-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[4,5-c]pyridin-3-yl]phenoxy]pyridine-3-carbonitrile (PubChem CID 134521416) has the molecular formula C26H22ClN7O2 and a molecular weight of 499.96 g/mol. Its IUPAC name is 4-[4-[4-amino-7-chloro-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[4,5-c]pyridin-3-yl]phenoxy]pyridine-3-carbonitrile.
| Compound Name | 4-[4-[4-amino-7-chloro-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[4,5-c]pyridin-3-yl]phenoxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134521416 |
| Molecular Formula | C26H22ClN7O2 |
| Molecular Weight | 499.96 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 4-[4-[4-amino-7-chloro-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[4,5-c]pyridin-3-yl]phenoxy]pyridine-3-carbonitrile |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4ccncc4C#N)cc3)c3c(N)ncc(Cl)c32)C1 |
| InChI | InChI=1S/C26H22ClN7O2/c1-2-22(35)33-11-3-4-18(15-33)34-25-20(27)14-31-26(29)23(25)24(32-34)16-5-7-19(8-6-16)36-21-9-10-30-13-17(21)12-28/h2,5-10,13-14,18H,1,3-4,11,15H2,(H2,29,31)/t18-/m1/s1 |
| InChIKey | KCLBLAJVXAPZID-GOSISDBHSA-N |
| XLogP | 4.74 |
| TPSA | 122.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.96 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|