C25H25ClN4O3 — CID 144571750
3-[4-(3-chlorophenoxy)phenyl]-N-methyl-1-(1-prop-2-enoylpiperidin-3-yl)pyrazole-4-carboxamide (PubChem CID 144571750) has the molecular formula C25H25ClN4O3 and a molecular weight of 464.95 g/mol. Its IUPAC name is 3-[4-(3-chlorophenoxy)phenyl]-N-methyl-1-(1-prop-2-enoylpiperidin-3-yl)pyrazole-4-carboxamide.
| Compound Name | 3-[4-(3-chlorophenoxy)phenyl]-N-methyl-1-(1-prop-2-enoylpiperidin-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144571750 |
| Molecular Formula | C25H25ClN4O3 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 3-[4-(3-chlorophenoxy)phenyl]-N-methyl-1-(1-prop-2-enoylpiperidin-3-yl)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CCCC(n2cc(C(=O)NC)c(-c3ccc(Oc4cccc(Cl)c4)cc3)n2)C1 |
| InChI | InChI=1S/C25H25ClN4O3/c1-3-23(31)29-13-5-7-19(15-29)30-16-22(25(32)27-2)24(28-30)17-9-11-20(12-10-17)33-21-8-4-6-18(26)14-21/h3-4,6,8-12,14,16,19H,1,5,7,13,15H2,2H3,(H,27,32) |
| InChIKey | BYDGCRFXVMABMG-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|