C25H26N4O2 — CID 73052743
3-(4-benzylphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazole-4-carboxamide (PubChem CID 73052743) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-(4-benzylphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-(4-benzylphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 73052743 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 3-(4-benzylphenyl)-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H](n2cc(C(N)=O)c(-c3ccc(Cc4ccccc4)cc3)n2)C1 |
| InChI | InChI=1S/C25H26N4O2/c1-2-23(30)28-14-6-9-21(16-28)29-17-22(25(26)31)24(27-29)20-12-10-19(11-13-20)15-18-7-4-3-5-8-18/h2-5,7-8,10-13,17,21H,1,6,9,14-16H2,(H2,26,31)/t21-/m1/s1 |
| InChIKey | GZYPOPVJARKJLO-OAQYLSRUSA-N |
| XLogP | 3.59 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|