C25H30N6O2 — CID 73052906
3-[4-[1-(2-methylpropyl)pyrazol-4-yl]phenyl]-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazole-4-carboxamide (PubChem CID 73052906) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 3-[4-[1-(2-methylpropyl)pyrazol-4-yl]phenyl]-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-[4-[1-(2-methylpropyl)pyrazol-4-yl]phenyl]-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 73052906 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 3-[4-[1-(2-methylpropyl)pyrazol-4-yl]phenyl]-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CCC[C@@H](n2cc(C(N)=O)c(-c3ccc(-c4cnn(CC(C)C)c4)cc3)n2)C1 |
| InChI | InChI=1S/C25H30N6O2/c1-4-23(32)29-11-5-6-21(15-29)31-16-22(25(26)33)24(28-31)19-9-7-18(8-10-19)20-12-27-30(14-20)13-17(2)3/h4,7-10,12,14,16-17,21H,1,5-6,11,13,15H2,2-3H3,(H2,26,33)/t21-/m1/s1 |
| InChIKey | OLIFQEUZCBKDPS-OAQYLSRUSA-N |
| XLogP | 3.52 |
| TPSA | 99.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|