C13H20N4O3 — CID 73013691
tert-butyl 4-(4-formyltriazol-1-yl)piperidine-1-carboxylate (PubChem CID 73013691) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is tert-butyl 4-(4-formyltriazol-1-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-formyltriazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 73013691 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | tert-butyl 4-(4-formyltriazol-1-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(C=O)nn2)CC1 |
| InChI | InChI=1S/C13H20N4O3/c1-13(2,3)20-12(19)16-6-4-11(5-7-16)17-8-10(9-18)14-15-17/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | FHKWIQQVFYABSA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|