C12H18N4O3 — CID 121208717
tert-butyl 3-(4-formyltriazol-1-yl)pyrrolidine-1-carboxylate (PubChem CID 121208717) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is tert-butyl 3-(4-formyltriazol-1-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-formyltriazol-1-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 121208717 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | tert-butyl 3-(4-formyltriazol-1-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(C=O)nn2)C1 |
| InChI | InChI=1S/C12H18N4O3/c1-12(2,3)19-11(18)15-5-4-10(7-15)16-6-9(8-17)13-14-16/h6,8,10H,4-5,7H2,1-3H3 |
| InChIKey | CPMFSSXZKFRCAC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|