C22H33NO2 — CID 156725948
tert-butyl 4-[(E)-2-(4-butan-2-ylphenyl)ethenyl]piperidine-1-carboxylate (PubChem CID 156725948) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is tert-butyl 4-[(E)-2-(4-butan-2-ylphenyl)ethenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(E)-2-(4-butan-2-ylphenyl)ethenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156725948 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | tert-butyl 4-[(E)-2-(4-butan-2-ylphenyl)ethenyl]piperidine-1-carboxylate |
| SMILES | CCC(C)c1ccc(/C=C/C2CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C22H33NO2/c1-6-17(2)20-11-9-18(10-12-20)7-8-19-13-15-23(16-14-19)21(24)25-22(3,4)5/h7-12,17,19H,6,13-16H2,1-5H3/b8-7+ |
| InChIKey | CEJDTIUZSOUFJM-BQYQJAHWSA-N |
| XLogP | 5.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |