C17H31Cl2NO2 — CID 123745424
tert-butyl 4-[(Z)-pent-1-enyl]piperidine-1-carboxylate;1,2-dichloroethane (PubChem CID 123745424) has the molecular formula C17H31Cl2NO2 and a molecular weight of 352.35 g/mol. Its IUPAC name is tert-butyl 4-[(Z)-pent-1-enyl]piperidine-1-carboxylate;1,2-dichloroethane.
| Compound Name | tert-butyl 4-[(Z)-pent-1-enyl]piperidine-1-carboxylate;1,2-dichloroethane |
|---|---|
| PubChem CID | 123745424 |
| Molecular Formula | C17H31Cl2NO2 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | tert-butyl 4-[(Z)-pent-1-enyl]piperidine-1-carboxylate;1,2-dichloroethane |
| SMILES | CCC/C=C\C1CCN(C(=O)OC(C)(C)C)CC1.ClCCCl |
| InChI | InChI=1S/C15H27NO2.C2H4Cl2/c1-5-6-7-8-13-9-11-16(12-10-13)14(17)18-15(2,3)4;3-1-2-4/h7-8,13H,5-6,9-12H2,1-4H3;1-2H2/b8-7-; |
| InChIKey | LKKCSPTXVKNLGB-CFYXSCKTSA-N |
| XLogP | 5.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|