C18H19N5O2S — CID 168607800
2-[5-(3-methylpiperidin-1-yl)-2-methylsulfonylanilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607800) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-[5-(3-methylpiperidin-1-yl)-2-methylsulfonylanilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[5-(3-methylpiperidin-1-yl)-2-methylsulfonylanilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607800 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-[5-(3-methylpiperidin-1-yl)-2-methylsulfonylanilino]ethene-1,1,2-tricarbonitrile |
| SMILES | CC1CCCN(c2ccc(S(C)(=O)=O)c(NC(C#N)=C(C#N)C#N)c2)C1 |
| InChI | InChI=1S/C18H19N5O2S/c1-13-4-3-7-23(12-13)15-5-6-18(26(2,24)25)16(8-15)22-17(11-21)14(9-19)10-20/h5-6,8,13,22H,3-4,7,12H2,1-2H3 |
| InChIKey | RMHWEFXYTSFTPN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|