C12H17N3O2S2 — CID 169356616
(2-methylsulfonyl-5-pyrrolidin-1-ylphenyl)thiourea (PubChem CID 169356616) has the molecular formula C12H17N3O2S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is (2-methylsulfonyl-5-pyrrolidin-1-ylphenyl)thiourea.
| Compound Name | (2-methylsulfonyl-5-pyrrolidin-1-ylphenyl)thiourea |
|---|---|
| PubChem CID | 169356616 |
| Molecular Formula | C12H17N3O2S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (2-methylsulfonyl-5-pyrrolidin-1-ylphenyl)thiourea |
| SMILES | CS(=O)(=O)c1ccc(N2CCCC2)cc1NC(N)=S |
| InChI | InChI=1S/C12H17N3O2S2/c1-19(16,17)11-5-4-9(15-6-2-3-7-15)8-10(11)14-12(13)18/h4-5,8H,2-3,6-7H2,1H3,(H3,13,14,18) |
| InChIKey | IDDGZQJOXQQPFV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|