C19H33NO4S — CID 145014951
ethane;methyl 2-methylsulfonyl-4-piperidin-1-ylbenzoate;propane (PubChem CID 145014951) has the molecular formula C19H33NO4S and a molecular weight of 371.54 g/mol. Its IUPAC name is ethane;methyl 2-methylsulfonyl-4-piperidin-1-ylbenzoate;propane.
| Compound Name | ethane;methyl 2-methylsulfonyl-4-piperidin-1-ylbenzoate;propane |
|---|---|
| PubChem CID | 145014951 |
| Molecular Formula | C19H33NO4S |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | ethane;methyl 2-methylsulfonyl-4-piperidin-1-ylbenzoate;propane |
| SMILES | CC.CCC.COC(=O)c1ccc(N2CCCCC2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C14H19NO4S.C3H8.C2H6/c1-19-14(16)12-7-6-11(10-13(12)20(2,17)18)15-8-4-3-5-9-15;1-3-2;1-2/h6-7,10H,3-5,8-9H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | OQIMLNPZNWITGQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |