C19H24N4O2S — CID 168543366
2-[[5-(3-methylpiperidin-1-yl)-2-propan-2-ylsulfonylanilino]methylidene]propanedinitrile (PubChem CID 168543366) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-[[5-(3-methylpiperidin-1-yl)-2-propan-2-ylsulfonylanilino]methylidene]propanedinitrile.
| Compound Name | 2-[[5-(3-methylpiperidin-1-yl)-2-propan-2-ylsulfonylanilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543366 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[[5-(3-methylpiperidin-1-yl)-2-propan-2-ylsulfonylanilino]methylidene]propanedinitrile |
| SMILES | CC1CCCN(c2ccc(S(=O)(=O)C(C)C)c(NC=C(C#N)C#N)c2)C1 |
| InChI | InChI=1S/C19H24N4O2S/c1-14(2)26(24,25)19-7-6-17(23-8-4-5-15(3)13-23)9-18(19)22-12-16(10-20)11-21/h6-7,9,12,14-15,22H,4-5,8,13H2,1-3H3 |
| InChIKey | PLGONPJEROUMNK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|