C17H21N7O2S — CID 169343936
3-[5-(3-methylpiperidin-1-yl)-2-methylsulfonylanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343936) has the molecular formula C17H21N7O2S and a molecular weight of 387.47 g/mol. Its IUPAC name is 3-[5-(3-methylpiperidin-1-yl)-2-methylsulfonylanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[5-(3-methylpiperidin-1-yl)-2-methylsulfonylanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343936 |
| Molecular Formula | C17H21N7O2S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 3-[5-(3-methylpiperidin-1-yl)-2-methylsulfonylanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | CC1CCCN(c2ccc(S(C)(=O)=O)c(NC=C(C#N)c3nn[nH]n3)c2)C1 |
| InChI | InChI=1S/C17H21N7O2S/c1-12-4-3-7-24(11-12)14-5-6-16(27(2,25)26)15(8-14)19-10-13(9-18)17-20-22-23-21-17/h5-6,8,10,12,19H,3-4,7,11H2,1-2H3,(H,20,21,22,23) |
| InChIKey | AOMXLCFXDBSALJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|