C15H15F2N7O — CID 169346568
3-[3,5-difluoro-4-(4-hydroxypiperidin-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346568) has the molecular formula C15H15F2N7O and a molecular weight of 347.33 g/mol. Its IUPAC name is 3-[3,5-difluoro-4-(4-hydroxypiperidin-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[3,5-difluoro-4-(4-hydroxypiperidin-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346568 |
| Molecular Formula | C15H15F2N7O |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 3-[3,5-difluoro-4-(4-hydroxypiperidin-1-yl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(F)c(N2CCC(O)CC2)c(F)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C15H15F2N7O/c16-12-5-10(19-8-9(7-18)15-20-22-23-21-15)6-13(17)14(12)24-3-1-11(25)2-4-24/h5-6,8,11,19,25H,1-4H2,(H,20,21,22,23) |
| InChIKey | ICDJIXPRXSTBSO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|