C17H19N7O2 — CID 169345263
5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(4-methylpiperidin-1-yl)benzoic acid (PubChem CID 169345263) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(4-methylpiperidin-1-yl)benzoic acid.
| Compound Name | 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(4-methylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 169345263 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 5-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-(4-methylpiperidin-1-yl)benzoic acid |
| SMILES | CC1CCN(c2ccc(NC=C(C#N)c3nn[nH]n3)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C17H19N7O2/c1-11-4-6-24(7-5-11)15-3-2-13(8-14(15)17(25)26)19-10-12(9-18)16-20-22-23-21-16/h2-3,8,10-11,19H,4-7H2,1H3,(H,25,26)(H,20,21,22,23) |
| InChIKey | JZBGTVFNNHYADK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 130.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|