C17H19Br2N7O — CID 169342404
3-[2,4-dibromo-6-[[(4-hydroxycyclohexyl)amino]methyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342404) has the molecular formula C17H19Br2N7O and a molecular weight of 497.20 g/mol. Its IUPAC name is 3-[2,4-dibromo-6-[[(4-hydroxycyclohexyl)amino]methyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2,4-dibromo-6-[[(4-hydroxycyclohexyl)amino]methyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342404 |
| Molecular Formula | C17H19Br2N7O |
| Molecular Weight | 497.20 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | 3-[2,4-dibromo-6-[[(4-hydroxycyclohexyl)amino]methyl]anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1c(Br)cc(Br)cc1CNC1CCC(O)CC1)c1nn[nH]n1 |
| InChI | InChI=1S/C17H19Br2N7O/c18-12-5-10(8-21-13-1-3-14(27)4-2-13)16(15(19)6-12)22-9-11(7-20)17-23-25-26-24-17/h5-6,9,13-14,21-22,27H,1-4,8H2,(H,23,24,25,26) |
| InChIKey | XGMRKYFYZYMADF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|