C14H16Br2N2O2 — CID 169352114
4-[(3,5-dibromo-2-isocyanatophenyl)methylamino]cyclohexan-1-ol (PubChem CID 169352114) has the molecular formula C14H16Br2N2O2 and a molecular weight of 404.10 g/mol. Its IUPAC name is 4-[(3,5-dibromo-2-isocyanatophenyl)methylamino]cyclohexan-1-ol.
| Compound Name | 4-[(3,5-dibromo-2-isocyanatophenyl)methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 169352114 |
| Molecular Formula | C14H16Br2N2O2 |
| Molecular Weight | 404.10 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | 4-[(3,5-dibromo-2-isocyanatophenyl)methylamino]cyclohexan-1-ol |
| SMILES | O=C=Nc1c(Br)cc(Br)cc1CNC1CCC(O)CC1 |
| InChI | InChI=1S/C14H16Br2N2O2/c15-10-5-9(14(18-8-19)13(16)6-10)7-17-11-1-3-12(20)4-2-11/h5-6,11-12,17,20H,1-4,7H2 |
| InChIKey | JQJXEVHFLPTJJL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.10 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|