C13H18Br2N2O — CID 153427955
4-[(2-amino-3,5-dibromophenyl)(113C)methylamino]cyclohexan-1-ol (PubChem CID 153427955) has the molecular formula C13H18Br2N2O and a molecular weight of 379.10 g/mol. Its IUPAC name is 4-[(2-amino-3,5-dibromophenyl)(113C)methylamino]cyclohexan-1-ol.
| Compound Name | 4-[(2-amino-3,5-dibromophenyl)(113C)methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 153427955 |
| Molecular Formula | C13H18Br2N2O |
| Molecular Weight | 379.10 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | 4-[(2-amino-3,5-dibromophenyl)(113C)methylamino]cyclohexan-1-ol |
| SMILES | Nc1c(Br)cc(Br)cc1[13CH2]NC1CCC(O)CC1 |
| InChI | InChI=1S/C13H18Br2N2O/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10/h5-6,10-11,17-18H,1-4,7,16H2/i7+1 |
| InChIKey | JBDGDEWWOUBZPM-CDYZYAPPSA-N |
| XLogP | 3.19 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.10 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|