C13H18Br2N2O — CID 166221083
3-[[(2-amino-3,5-dibromophenyl)methylamino]methyl]cyclopentan-1-ol (PubChem CID 166221083) has the molecular formula C13H18Br2N2O and a molecular weight of 378.11 g/mol. Its IUPAC name is 3-[[(2-amino-3,5-dibromophenyl)methylamino]methyl]cyclopentan-1-ol.
| Compound Name | 3-[[(2-amino-3,5-dibromophenyl)methylamino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 166221083 |
| Molecular Formula | C13H18Br2N2O |
| Molecular Weight | 378.11 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | 3-[[(2-amino-3,5-dibromophenyl)methylamino]methyl]cyclopentan-1-ol |
| SMILES | Nc1c(Br)cc(Br)cc1CNCC1CCC(O)C1 |
| InChI | InChI=1S/C13H18Br2N2O/c14-10-4-9(13(16)12(15)5-10)7-17-6-8-1-2-11(18)3-8/h4-5,8,11,17-18H,1-3,6-7,16H2 |
| InChIKey | UNSJIUUKDNZIPN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.11 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|