C13H18Br2N3O4- — CID 11690726
4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexan-1-ol nitrate (PubChem CID 11690726) has the molecular formula C13H18Br2N3O4- and a molecular weight of 440.11 g/mol. Its IUPAC name is 4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexan-1-ol nitrate.
| Compound Name | 4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexan-1-ol nitrate |
|---|---|
| PubChem CID | 11690726 |
| Molecular Formula | C13H18Br2N3O4- |
| Molecular Weight | 440.11 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | 4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexan-1-ol nitrate |
| SMILES | Nc1c(Br)cc(Br)cc1CNC1CCC(O)CC1.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C13H18Br2N2O.NO3/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10;2-1(3)4/h5-6,10-11,17-18H,1-4,7,16H2;/q;-1 |
| InChIKey | PZPQWESPJDNQLC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.11 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|