About [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate
[4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate (PubChem CID 132520170) has the molecular formula C20H22Br2N2O2
and a molecular weight of 482.22 g/mol. Its IUPAC name is [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate.
Molecular Properties
| Compound Name | [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate |
| PubChem CID | 132520170 |
| Molecular Formula | C20H22Br2N2O2 |
| Molecular Weight | 482.22 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate |
| SMILES | Nc1c(Br)cc(Br)cc1CNC1CCC(OC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H22Br2N2O2/c21-15-10-14(19(23)18(22)11-15)12-24-16-6-8-17(9-7-16)26-20(25)13-4-2-1-3-5-13/h1-5,10-11,16-17,24H,6-9,12,23H2 |
| InChIKey | CITWKNWSZULKSZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.22 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate?
The IUPAC name of [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate (CID 132520170) is [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate.
What is the SMILES notation for [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate?
The canonical SMILES for [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate is Nc1c(Br)cc(Br)cc1CNC1CCC(OC(=O)c2ccccc2)CC1.
What is the InChIKey of [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate?
The InChIKey is CITWKNWSZULKSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22Br2N2O2/c21-15-10-14(19(23)18(22)11-15)12-24-16-6-8-17(9-7-16)26-20(25)13-4-2-1-3-5-13/h1-5,10-11,16-17,24H,6-9,12,23H2.
What are the key properties of [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate?
[4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate has a molecular weight of 482.22 g/mol, XLogP of 5.05, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-amino-3,5-dibromophenyl)methylamino]cyclohexyl] benzoate is sourced from PubChem (CID 132520170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).