C14H11Br2NO2 — CID 154191248
(2-amino-3,5-dibromophenyl)methyl benzoate (PubChem CID 154191248) has the molecular formula C14H11Br2NO2 and a molecular weight of 385.06 g/mol. Its IUPAC name is (2-amino-3,5-dibromophenyl)methyl benzoate.
| Compound Name | (2-amino-3,5-dibromophenyl)methyl benzoate |
|---|---|
| PubChem CID | 154191248 |
| Molecular Formula | C14H11Br2NO2 |
| Molecular Weight | 385.06 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | (2-amino-3,5-dibromophenyl)methyl benzoate |
| SMILES | Nc1c(Br)cc(Br)cc1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H11Br2NO2/c15-11-6-10(13(17)12(16)7-11)8-19-14(18)9-4-2-1-3-5-9/h1-7H,8,17H2 |
| InChIKey | OPSGXDRGDXGWRZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.06 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|