C14H21BrN2O — CID 147172398
4-[[(2-amino-3-bromo-5-methylphenyl)-dideuteriomethyl]amino]cyclohexan-1-ol (PubChem CID 147172398) has the molecular formula C14H21BrN2O and a molecular weight of 315.25 g/mol. Its IUPAC name is 4-[[(2-amino-3-bromo-5-methylphenyl)-dideuteriomethyl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[(2-amino-3-bromo-5-methylphenyl)-dideuteriomethyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 147172398 |
| Molecular Formula | C14H21BrN2O |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-[[(2-amino-3-bromo-5-methylphenyl)-dideuteriomethyl]amino]cyclohexan-1-ol |
| SMILES | [2H]C([2H])(NC1CCC(O)CC1)c1cc(C)cc(Br)c1N |
| InChI | InChI=1S/C14H21BrN2O/c1-9-6-10(14(16)13(15)7-9)8-17-11-2-4-12(18)5-3-11/h6-7,11-12,17-18H,2-5,8,16H2,1H3/i8D2 |
| InChIKey | BXYYWFUZNRIDHA-MGVXTIMCSA-N |
| XLogP | 2.73 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|