C13H19Br2ClN2O — CID 45379479
4-[(2-amino-3,5-dibromophenyl)(114C)methylamino]cyclohexan-1-ol;hydrochloride (PubChem CID 45379479) has the molecular formula C13H19Br2ClN2O and a molecular weight of 416.56 g/mol. Its IUPAC name is 4-[(2-amino-3,5-dibromophenyl)(114C)methylamino]cyclohexan-1-ol;hydrochloride.
| Compound Name | 4-[(2-amino-3,5-dibromophenyl)(114C)methylamino]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 45379479 |
| Molecular Formula | C13H19Br2ClN2O |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | 4-[(2-amino-3,5-dibromophenyl)(114C)methylamino]cyclohexan-1-ol;hydrochloride |
| SMILES | Cl.Nc1c(Br)cc(Br)cc1[14CH2]NC1CCC(O)CC1 |
| InChI | InChI=1S/C13H18Br2N2O.ClH/c14-9-5-8(13(16)12(15)6-9)7-17-10-1-3-11(18)4-2-10;/h5-6,10-11,17-18H,1-4,7,16H2;1H/i7+2; |
| InChIKey | QNVKOSLOVOTXKF-ZMCFIIMUSA-N |
| XLogP | 3.61 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|