C14H14N2O4 — CID 16647728
ethyl 4-[(1-methyl-2,5-dioxopyrrol-3-yl)amino]benzoate (PubChem CID 16647728) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is ethyl 4-[(1-methyl-2,5-dioxopyrrol-3-yl)amino]benzoate.
| Compound Name | ethyl 4-[(1-methyl-2,5-dioxopyrrol-3-yl)amino]benzoate |
|---|---|
| PubChem CID | 16647728 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | ethyl 4-[(1-methyl-2,5-dioxopyrrol-3-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC2=CC(=O)N(C)C2=O)cc1 |
| InChI | InChI=1S/C14H14N2O4/c1-3-20-14(19)9-4-6-10(7-5-9)15-11-8-12(17)16(2)13(11)18/h4-8,15H,3H2,1-2H3 |
| InChIKey | WLICJFAFOGSZQJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|