C14H19F2NO2S — CID 178050421
4,4-difluoro-1-(4-propan-2-ylphenyl)sulfonylpiperidine (PubChem CID 178050421) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is 4,4-difluoro-1-(4-propan-2-ylphenyl)sulfonylpiperidine.
| Compound Name | 4,4-difluoro-1-(4-propan-2-ylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 178050421 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4,4-difluoro-1-(4-propan-2-ylphenyl)sulfonylpiperidine |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C14H19F2NO2S/c1-11(2)12-3-5-13(6-4-12)20(18,19)17-9-7-14(15,16)8-10-17/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | JBDQLZVQRDINKH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |