C17H25NO6S3 — CID 42654682
N-cycloheptyl-3-(1,1-dioxothiolan-3-yl)sulfonylbenzenesulfonamide (PubChem CID 42654682) has the molecular formula C17H25NO6S3 and a molecular weight of 435.59 g/mol. Its IUPAC name is N-cycloheptyl-3-(1,1-dioxothiolan-3-yl)sulfonylbenzenesulfonamide.
| Compound Name | N-cycloheptyl-3-(1,1-dioxothiolan-3-yl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 42654682 |
| Molecular Formula | C17H25NO6S3 |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | N-cycloheptyl-3-(1,1-dioxothiolan-3-yl)sulfonylbenzenesulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)c2cccc(S(=O)(=O)NC3CCCCCC3)c2)C1 |
| InChI | InChI=1S/C17H25NO6S3/c19-25(20)11-10-17(13-25)26(21,22)15-8-5-9-16(12-15)27(23,24)18-14-6-3-1-2-4-7-14/h5,8-9,12,14,17-18H,1-4,6-7,10-11,13H2 |
| InChIKey | YLFXTBAYFKLVRW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |