C14H21FN2O5S — CID 55407905
2-fluoro-N-[3-(2-methoxyethoxy)propyl]-5-(methylsulfamoyl)benzamide (PubChem CID 55407905) has the molecular formula C14H21FN2O5S and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-fluoro-N-[3-(2-methoxyethoxy)propyl]-5-(methylsulfamoyl)benzamide.
| Compound Name | 2-fluoro-N-[3-(2-methoxyethoxy)propyl]-5-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55407905 |
| Molecular Formula | C14H21FN2O5S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-fluoro-N-[3-(2-methoxyethoxy)propyl]-5-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1ccc(F)c(C(=O)NCCCOCCOC)c1 |
| InChI | InChI=1S/C14H21FN2O5S/c1-16-23(19,20)11-4-5-13(15)12(10-11)14(18)17-6-3-7-22-9-8-21-2/h4-5,10,16H,3,6-9H2,1-2H3,(H,17,18) |
| InChIKey | SDCKSNSOKAHDAU-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|