C13H16ClF2NO3 — CID 134029639
2-chloro-4,5-difluoro-N-[3-(2-methoxyethoxy)propyl]benzamide (PubChem CID 134029639) has the molecular formula C13H16ClF2NO3 and a molecular weight of 307.72 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[3-(2-methoxyethoxy)propyl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[3-(2-methoxyethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 134029639 |
| Molecular Formula | C13H16ClF2NO3 |
| Molecular Weight | 307.72 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[3-(2-methoxyethoxy)propyl]benzamide |
| SMILES | COCCOCCCNC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H16ClF2NO3/c1-19-5-6-20-4-2-3-17-13(18)9-7-11(15)12(16)8-10(9)14/h7-8H,2-6H2,1H3,(H,17,18) |
| InChIKey | RUKDPCPTGPXZOG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|