C19H28N4O5S — CID 55706244
1-benzyl-3-[1-[2-[2-(1,1-dioxothiolan-3-yl)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea (PubChem CID 55706244) has the molecular formula C19H28N4O5S and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-benzyl-3-[1-[2-[2-(1,1-dioxothiolan-3-yl)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea.
| Compound Name | 1-benzyl-3-[1-[2-[2-(1,1-dioxothiolan-3-yl)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 55706244 |
| Molecular Formula | C19H28N4O5S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-benzyl-3-[1-[2-[2-(1,1-dioxothiolan-3-yl)acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]urea |
| SMILES | CC(C)C(NC(=O)NCc1ccccc1)C(=O)NNC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H28N4O5S/c1-13(2)17(21-19(26)20-11-14-6-4-3-5-7-14)18(25)23-22-16(24)10-15-8-9-29(27,28)12-15/h3-7,13,15,17H,8-12H2,1-2H3,(H,22,24)(H,23,25)(H2,20,21,26) |
| InChIKey | RRXWWLHUOJMCIS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|