C20H21NO5S — CID 55405543
[2-oxo-2-(4-phenylanilino)ethyl] 2-(1,1-dioxothiolan-3-yl)acetate (PubChem CID 55405543) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylanilino)ethyl] 2-(1,1-dioxothiolan-3-yl)acetate.
| Compound Name | [2-oxo-2-(4-phenylanilino)ethyl] 2-(1,1-dioxothiolan-3-yl)acetate |
|---|---|
| PubChem CID | 55405543 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [2-oxo-2-(4-phenylanilino)ethyl] 2-(1,1-dioxothiolan-3-yl)acetate |
| SMILES | O=C(COC(=O)CC1CCS(=O)(=O)C1)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21NO5S/c22-19(13-26-20(23)12-15-10-11-27(24,25)14-15)21-18-8-6-17(7-9-18)16-4-2-1-3-5-16/h1-9,15H,10-14H2,(H,21,22) |
| InChIKey | NDHKFAQYNNCVGI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |