C15H18N2O6S — CID 55425984
[2-(benzylcarbamoylamino)-2-oxoethyl] 1,1-dioxothiolane-3-carboxylate (PubChem CID 55425984) has the molecular formula C15H18N2O6S and a molecular weight of 354.38 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 1,1-dioxothiolane-3-carboxylate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 1,1-dioxothiolane-3-carboxylate |
|---|---|
| PubChem CID | 55425984 |
| Molecular Formula | C15H18N2O6S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 1,1-dioxothiolane-3-carboxylate |
| SMILES | O=C(COC(=O)C1CCS(=O)(=O)C1)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H18N2O6S/c18-13(9-23-14(19)12-6-7-24(21,22)10-12)17-15(20)16-8-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H2,16,17,18,20) |
| InChIKey | AZPYLMZDXMIFLN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |