C19H21NO4S — CID 55689181
1,1-dioxo-N-[[4-(phenoxymethyl)phenyl]methyl]thiolane-3-carboxamide (PubChem CID 55689181) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is 1,1-dioxo-N-[[4-(phenoxymethyl)phenyl]methyl]thiolane-3-carboxamide.
| Compound Name | 1,1-dioxo-N-[[4-(phenoxymethyl)phenyl]methyl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 55689181 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1,1-dioxo-N-[[4-(phenoxymethyl)phenyl]methyl]thiolane-3-carboxamide |
| SMILES | O=C(NCc1ccc(COc2ccccc2)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21NO4S/c21-19(17-10-11-25(22,23)14-17)20-12-15-6-8-16(9-7-15)13-24-18-4-2-1-3-5-18/h1-9,17H,10-14H2,(H,20,21) |
| InChIKey | VEBWLMAOJASAJA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |