C14H17N3O5S — CID 9082212
N-[2-[2-[(3R)-1,1-dioxothiolane-3-carbonyl]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 9082212) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is N-[2-[2-[(3R)-1,1-dioxothiolane-3-carbonyl]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[2-[(3R)-1,1-dioxothiolane-3-carbonyl]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9082212 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[2-[2-[(3R)-1,1-dioxothiolane-3-carbonyl]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1)NNC(=O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17N3O5S/c18-12(8-15-13(19)10-4-2-1-3-5-10)16-17-14(20)11-6-7-23(21,22)9-11/h1-5,11H,6-9H2,(H,15,19)(H,16,18)(H,17,20)/t11-/m0/s1 |
| InChIKey | JDRNQDJICMKYLN-NSHDSACASA-N |
| XLogP | -1.00 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|