C19H20N2O4S — CID 41282814
(3S)-N'-(2-benzylbenzoyl)-1,1-dioxothiolane-3-carbohydrazide (PubChem CID 41282814) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (3S)-N'-(2-benzylbenzoyl)-1,1-dioxothiolane-3-carbohydrazide.
| Compound Name | (3S)-N'-(2-benzylbenzoyl)-1,1-dioxothiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 41282814 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (3S)-N'-(2-benzylbenzoyl)-1,1-dioxothiolane-3-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@@H]1CCS(=O)(=O)C1)c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C19H20N2O4S/c22-18(16-10-11-26(24,25)13-16)20-21-19(23)17-9-5-4-8-15(17)12-14-6-2-1-3-7-14/h1-9,16H,10-13H2,(H,20,22)(H,21,23)/t16-/m1/s1 |
| InChIKey | OHAMLXUAQDZUEX-MRXNPFEDSA-N |
| XLogP | 1.47 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|