C14H19NO3S — CID 18156664
N-[2-(2-methylphenyl)ethyl]-1,1-dioxothiolane-3-carboxamide (PubChem CID 18156664) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-[2-(2-methylphenyl)ethyl]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-[2-(2-methylphenyl)ethyl]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 18156664 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-[2-(2-methylphenyl)ethyl]-1,1-dioxothiolane-3-carboxamide |
| SMILES | Cc1ccccc1CCNC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19NO3S/c1-11-4-2-3-5-12(11)6-8-15-14(16)13-7-9-19(17,18)10-13/h2-5,13H,6-10H2,1H3,(H,15,16) |
| InChIKey | FCOMLPDSCOCEGE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |