C20H22N2O4S — CID 135817879
(3R)-N-[(E)-[1-(2-hydroxyphenyl)-3-phenylpropylidene]amino]-1,1-dioxothiolane-3-carboxamide (PubChem CID 135817879) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is (3R)-N-[(E)-[1-(2-hydroxyphenyl)-3-phenylpropylidene]amino]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3R)-N-[(E)-[1-(2-hydroxyphenyl)-3-phenylpropylidene]amino]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 135817879 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (3R)-N-[(E)-[1-(2-hydroxyphenyl)-3-phenylpropylidene]amino]-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(N/N=C(\CCc1ccccc1)c1ccccc1O)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H22N2O4S/c23-19-9-5-4-8-17(19)18(11-10-15-6-2-1-3-7-15)21-22-20(24)16-12-13-27(25,26)14-16/h1-9,16,23H,10-14H2,(H,22,24)/b21-18+/t16-/m0/s1 |
| InChIKey | QBPRDQZIFMSZPV-QMWCZEAPSA-N |
| XLogP | 2.28 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|