C13H15BrN2O4S — CID 135817840
(3R)-N-[(E)-1-(5-bromo-2-hydroxyphenyl)ethylideneamino]-1,1-dioxothiolane-3-carboxamide (PubChem CID 135817840) has the molecular formula C13H15BrN2O4S and a molecular weight of 375.24 g/mol. Its IUPAC name is (3R)-N-[(E)-1-(5-bromo-2-hydroxyphenyl)ethylideneamino]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3R)-N-[(E)-1-(5-bromo-2-hydroxyphenyl)ethylideneamino]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 135817840 |
| Molecular Formula | C13H15BrN2O4S |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | (3R)-N-[(E)-1-(5-bromo-2-hydroxyphenyl)ethylideneamino]-1,1-dioxothiolane-3-carboxamide |
| SMILES | C/C(=N\NC(=O)[C@H]1CCS(=O)(=O)C1)c1cc(Br)ccc1O |
| InChI | InChI=1S/C13H15BrN2O4S/c1-8(11-6-10(14)2-3-12(11)17)15-16-13(18)9-4-5-21(19,20)7-9/h2-3,6,9,17H,4-5,7H2,1H3,(H,16,18)/b15-8+/t9-/m0/s1 |
| InChIKey | BLEASCKXJCOUNF-HVIDBACLSA-N |
| XLogP | 1.43 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|