C11H13BrN2O3S — CID 64913377
N-(2-amino-4-bromophenyl)-1,1-dioxothiolane-3-carboxamide (PubChem CID 64913377) has the molecular formula C11H13BrN2O3S and a molecular weight of 333.21 g/mol. Its IUPAC name is N-(2-amino-4-bromophenyl)-1,1-dioxothiolane-3-carboxamide.
| Compound Name | N-(2-amino-4-bromophenyl)-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 64913377 |
| Molecular Formula | C11H13BrN2O3S |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | N-(2-amino-4-bromophenyl)-1,1-dioxothiolane-3-carboxamide |
| SMILES | Nc1cc(Br)ccc1NC(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13BrN2O3S/c12-8-1-2-10(9(13)5-8)14-11(15)7-3-4-18(16,17)6-7/h1-2,5,7H,3-4,6,13H2,(H,14,15) |
| InChIKey | HMDVWKGYLDLKKQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|