C14H14BrN3O3S — CID 135817790
(3R)-N-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-1,1-dioxothiolane-3-carboxamide (PubChem CID 135817790) has the molecular formula C14H14BrN3O3S and a molecular weight of 384.26 g/mol. Its IUPAC name is (3R)-N-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-1,1-dioxothiolane-3-carboxamide.
| Compound Name | (3R)-N-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-1,1-dioxothiolane-3-carboxamide |
|---|---|
| PubChem CID | 135817790 |
| Molecular Formula | C14H14BrN3O3S |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | (3R)-N-[(E)-(5-bromo-1H-indol-3-yl)methylideneamino]-1,1-dioxothiolane-3-carboxamide |
| SMILES | O=C(N/N=C/c1c[nH]c2ccc(Br)cc12)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H14BrN3O3S/c15-11-1-2-13-12(5-11)10(6-16-13)7-17-18-14(19)9-3-4-22(20,21)8-9/h1-2,5-7,9,16H,3-4,8H2,(H,18,19)/b17-7+/t9-/m0/s1 |
| InChIKey | PVOLPXITORSSEX-AYNSVGMASA-N |
| XLogP | 1.82 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|