C16H20N2O4S3 — CID 9142044
(3R)-N'-[4-(1,3-dithian-2-yl)benzoyl]-1,1-dioxothiolane-3-carbohydrazide (PubChem CID 9142044) has the molecular formula C16H20N2O4S3 and a molecular weight of 400.55 g/mol. Its IUPAC name is (3R)-N'-[4-(1,3-dithian-2-yl)benzoyl]-1,1-dioxothiolane-3-carbohydrazide.
| Compound Name | (3R)-N'-[4-(1,3-dithian-2-yl)benzoyl]-1,1-dioxothiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 9142044 |
| Molecular Formula | C16H20N2O4S3 |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | (3R)-N'-[4-(1,3-dithian-2-yl)benzoyl]-1,1-dioxothiolane-3-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@H]1CCS(=O)(=O)C1)c1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C16H20N2O4S3/c19-14(17-18-15(20)13-6-9-25(21,22)10-13)11-2-4-12(5-3-11)16-23-7-1-8-24-16/h2-5,13,16H,1,6-10H2,(H,17,19)(H,18,20)/t13-/m0/s1 |
| InChIKey | IXPIDVMNVPKRRH-ZDUSSCGKSA-N |
| XLogP | 1.75 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|