C16H24N2O4S — CID 94434539
(3R)-N'-(adamantane-2-carbonyl)-1,1-dioxothiolane-3-carbohydrazide (PubChem CID 94434539) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is (3R)-N'-(adamantane-2-carbonyl)-1,1-dioxothiolane-3-carbohydrazide.
| Compound Name | (3R)-N'-(adamantane-2-carbonyl)-1,1-dioxothiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 94434539 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (3R)-N'-(adamantane-2-carbonyl)-1,1-dioxothiolane-3-carbohydrazide |
| SMILES | O=C(NNC(=O)[C@H]1CCS(=O)(=O)C1)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H24N2O4S/c19-15(11-1-2-23(21,22)8-11)17-18-16(20)14-12-4-9-3-10(6-12)7-13(14)5-9/h9-14H,1-8H2,(H,17,19)(H,18,20)/t9?,10?,11-,12?,13?,14?/m0/s1 |
| InChIKey | PBZVLHDSUOCRPJ-FZLVIXCJSA-N |
| XLogP | 0.64 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|