C11H9F5N2O3S — CID 9089043
(3S)-1,1-dioxo-N'-(2,3,4,5,6-pentafluorophenyl)thiolane-3-carbohydrazide (PubChem CID 9089043) has the molecular formula C11H9F5N2O3S and a molecular weight of 344.26 g/mol. Its IUPAC name is (3S)-1,1-dioxo-N'-(2,3,4,5,6-pentafluorophenyl)thiolane-3-carbohydrazide.
| Compound Name | (3S)-1,1-dioxo-N'-(2,3,4,5,6-pentafluorophenyl)thiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 9089043 |
| Molecular Formula | C11H9F5N2O3S |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | (3S)-1,1-dioxo-N'-(2,3,4,5,6-pentafluorophenyl)thiolane-3-carbohydrazide |
| SMILES | O=C(NNc1c(F)c(F)c(F)c(F)c1F)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H9F5N2O3S/c12-5-6(13)8(15)10(9(16)7(5)14)17-18-11(19)4-1-2-22(20,21)3-4/h4,17H,1-3H2,(H,18,19)/t4-/m1/s1 |
| InChIKey | IVDSUOHQRWSNKI-SCSAIBSYSA-N |
| XLogP | 1.26 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|