C18H19F5N2OS2 — CID 35621269
(1'S,5'R)-N'-(2,3,4,5,6-pentafluorophenyl)spiro[1,3-dithiolane-2,9'-bicyclo[3.3.1]nonane]-3'-carbohydrazide (PubChem CID 35621269) has the molecular formula C18H19F5N2OS2 and a molecular weight of 438.49 g/mol. Its IUPAC name is (1'S,5'R)-N'-(2,3,4,5,6-pentafluorophenyl)spiro[1,3-dithiolane-2,9'-bicyclo[3.3.1]nonane]-3'-carbohydrazide.
| Compound Name | (1'S,5'R)-N'-(2,3,4,5,6-pentafluorophenyl)spiro[1,3-dithiolane-2,9'-bicyclo[3.3.1]nonane]-3'-carbohydrazide |
|---|---|
| PubChem CID | 35621269 |
| Molecular Formula | C18H19F5N2OS2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (1'S,5'R)-N'-(2,3,4,5,6-pentafluorophenyl)spiro[1,3-dithiolane-2,9'-bicyclo[3.3.1]nonane]-3'-carbohydrazide |
| SMILES | O=C(NNc1c(F)c(F)c(F)c(F)c1F)C1C[C@H]2CCC[C@@H](C1)C21SCCS1 |
| InChI | InChI=1S/C18H19F5N2OS2/c19-11-12(20)14(22)16(15(23)13(11)21)24-25-17(26)8-6-9-2-1-3-10(7-8)18(9)27-4-5-28-18/h8-10,24H,1-7H2,(H,25,26)/t8?,9-,10+ |
| InChIKey | LGZOLTXYVKBJPC-PBINXNQUSA-N |
| XLogP | 4.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|