C18H20Cl3NOS2 — CID 3270742
N-(2,4,5-trichlorophenyl)spiro[1,3-dithiolane-2,9'-bicyclo[3.3.1]nonane]-3'-carboxamide (PubChem CID 3270742) has the molecular formula C18H20Cl3NOS2 and a molecular weight of 436.86 g/mol. Its IUPAC name is N-(2,4,5-trichlorophenyl)spiro[1,3-dithiolane-2,9'-bicyclo[3.3.1]nonane]-3'-carboxamide.
| Compound Name | N-(2,4,5-trichlorophenyl)spiro[1,3-dithiolane-2,9'-bicyclo[3.3.1]nonane]-3'-carboxamide |
|---|---|
| PubChem CID | 3270742 |
| Molecular Formula | C18H20Cl3NOS2 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | N-(2,4,5-trichlorophenyl)spiro[1,3-dithiolane-2,9'-bicyclo[3.3.1]nonane]-3'-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C1CC2CCCC(C1)C21SCCS1 |
| InChI | InChI=1S/C18H20Cl3NOS2/c19-13-8-15(21)16(9-14(13)20)22-17(23)10-6-11-2-1-3-12(7-10)18(11)24-4-5-25-18/h8-12H,1-7H2,(H,22,23) |
| InChIKey | UWQOXFUGXIEHTE-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|