C13H15Cl3N2O — CID 64817565
2-amino-N-(2,4,5-trichlorophenyl)cyclohexane-1-carboxamide (PubChem CID 64817565) has the molecular formula C13H15Cl3N2O and a molecular weight of 321.64 g/mol. Its IUPAC name is 2-amino-N-(2,4,5-trichlorophenyl)cyclohexane-1-carboxamide.
| Compound Name | 2-amino-N-(2,4,5-trichlorophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 64817565 |
| Molecular Formula | C13H15Cl3N2O |
| Molecular Weight | 321.64 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2-amino-N-(2,4,5-trichlorophenyl)cyclohexane-1-carboxamide |
| SMILES | NC1CCCCC1C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H15Cl3N2O/c14-8-5-10(16)12(6-9(8)15)18-13(19)7-3-1-2-4-11(7)17/h5-7,11H,1-4,17H2,(H,18,19) |
| InChIKey | RBLBDHDESCWLLM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.64 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|