C12H13Cl2FN2O — CID 107574334
2-amino-N-(3,5-dichloro-4-fluorophenyl)cyclopentane-1-carboxamide (PubChem CID 107574334) has the molecular formula C12H13Cl2FN2O and a molecular weight of 291.15 g/mol. Its IUPAC name is 2-amino-N-(3,5-dichloro-4-fluorophenyl)cyclopentane-1-carboxamide.
| Compound Name | 2-amino-N-(3,5-dichloro-4-fluorophenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 107574334 |
| Molecular Formula | C12H13Cl2FN2O |
| Molecular Weight | 291.15 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-amino-N-(3,5-dichloro-4-fluorophenyl)cyclopentane-1-carboxamide |
| SMILES | NC1CCCC1C(=O)Nc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2FN2O/c13-8-4-6(5-9(14)11(8)15)17-12(18)7-2-1-3-10(7)16/h4-5,7,10H,1-3,16H2,(H,17,18) |
| InChIKey | BHZPHPWRZSVSRP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.15 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|